C26H50O8Si — CID 11813311
2-[[(2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienoxy]methoxy]ethyl-trimethylsilane (PubChem CID 11813311) has the molecular formula C26H50O8Si and a molecular weight of 518.76 g/mol. Its IUPAC name is 2-[[(2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 11813311 |
| Molecular Formula | C26H50O8Si |
| Molecular Weight | 518.76 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | 2-[[(2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienoxy]methoxy]ethyl-trimethylsilane |
| SMILES | COCO[C@@H]([C@H](CC(C)(C)/C=C/C=C/COCOCC[Si](C)(C)C)OCOC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C26H50O8Si/c1-25(2,13-11-10-12-14-29-21-30-15-16-35(7,8)9)17-22(31-19-27-5)24(32-20-28-6)23-18-33-26(3,4)34-23/h10-13,22-24H,14-21H2,1-9H3/b12-10+,13-11+/t22-,23+,24-/m0/s1 |
| InChIKey | VOFYWVKXXWZBBD-AMISFHLJSA-N |
| XLogP | 4.97 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.76 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|