C49H37N5 — CID 118133161
3-(9-tert-butylcarbazol-3-yl)-9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 118133161) has the molecular formula C49H37N5 and a molecular weight of 695.87 g/mol. Its IUPAC name is 3-(9-tert-butylcarbazol-3-yl)-9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 3-(9-tert-butylcarbazol-3-yl)-9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 118133161 |
| Molecular Formula | C49H37N5 |
| Molecular Weight | 695.87 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | 3-(9-tert-butylcarbazol-3-yl)-9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | CC(C)(C)n1c2ccccc2c2cc(-c3ccc4c(c3)c3ccccc3n4-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc21 |
| InChI | InChI=1S/C49H37N5/c1-49(2,3)54-44-24-13-11-22-39(44)41-31-35(26-28-45(41)54)34-25-27-43-40(30-34)38-21-10-12-23-42(38)53(43)37-20-14-19-36(29-37)48-51-46(32-15-6-4-7-16-32)50-47(52-48)33-17-8-5-9-18-33/h4-31H,1-3H3 |
| InChIKey | ACOQMNHVDXEDRB-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.87 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |