C18H21N5O2 — CID 118133336
1-[1-(5-acetyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]prop-2-en-1-one (PubChem CID 118133336) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-[1-(5-acetyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]prop-2-en-1-one.
| Compound Name | 1-[1-(5-acetyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118133336 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-[1-(5-acetyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC2CCN(c3ncnc4[nH]cc(C(C)=O)c34)C2C1 |
| InChI | InChI=1S/C18H21N5O2/c1-3-15(25)22-6-4-12-5-7-23(14(12)9-22)18-16-13(11(2)24)8-19-17(16)20-10-21-18/h3,8,10,12,14H,1,4-7,9H2,2H3,(H,19,20,21) |
| InChIKey | HYGCESLOFGIEMD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|