C24H48O8Si2 — CID 11813338
diethyl (E,4R,5R,6R,7R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6,7-dihydroxyoct-2-enedioate (PubChem CID 11813338) has the molecular formula C24H48O8Si2 and a molecular weight of 520.81 g/mol. Its IUPAC name is diethyl (E,4R,5R,6R,7R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6,7-dihydroxyoct-2-enedioate.
| Compound Name | diethyl (E,4R,5R,6R,7R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6,7-dihydroxyoct-2-enedioate |
|---|---|
| PubChem CID | 11813338 |
| Molecular Formula | C24H48O8Si2 |
| Molecular Weight | 520.81 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | diethyl (E,4R,5R,6R,7R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6,7-dihydroxyoct-2-enedioate |
| SMILES | CCOC(=O)/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)C(=O)OCC |
| InChI | InChI=1S/C24H48O8Si2/c1-13-29-18(25)16-15-17(31-33(9,10)23(3,4)5)21(32-34(11,12)24(6,7)8)19(26)20(27)22(28)30-14-2/h15-17,19-21,26-27H,13-14H2,1-12H3/b16-15+/t17-,19-,20-,21+/m1/s1 |
| InChIKey | AWJLAIDPKDJELT-ZGADQTKBSA-N |
| XLogP | 4.17 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|