About 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine
4-(4-tert-butylphenyl)-1,4-dimethylpiperidine (PubChem CID 118133394) has the molecular formula C17H27N
and a molecular weight of 245.41 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine.
Molecular Properties
| Compound Name | 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine |
| PubChem CID | 118133394 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine |
| SMILES | CN1CCC(C)(c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C17H27N/c1-16(2,3)14-6-8-15(9-7-14)17(4)10-12-18(5)13-11-17/h6-9H,10-13H2,1-5H3 |
| InChIKey | VSZMHVBQWINKRY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine?
The IUPAC name of 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine (CID 118133394) is 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine.
What is the SMILES notation for 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine?
The canonical SMILES for 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine is CN1CCC(C)(c2ccc(C(C)(C)C)cc2)CC1.
What is the InChIKey of 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine?
The InChIKey is VSZMHVBQWINKRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N/c1-16(2,3)14-6-8-15(9-7-14)17(4)10-12-18(5)13-11-17/h6-9H,10-13H2,1-5H3.
What are the key properties of 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine?
4-(4-tert-butylphenyl)-1,4-dimethylpiperidine has a molecular weight of 245.41 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-tert-butylphenyl)-1,4-dimethylpiperidine is sourced from PubChem (CID 118133394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).