About 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone
1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone (PubChem CID 118133829) has the molecular formula C11H16FN5O
and a molecular weight of 253.28 g/mol. Its IUPAC name is 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone |
| PubChem CID | 118133829 |
| Molecular Formula | C11H16FN5O |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CCN(c2ncnc(N)c2F)C[C@@H]1N |
| InChI | InChI=1S/C11H16FN5O/c1-6(18)7-2-3-17(4-8(7)13)11-9(12)10(14)15-5-16-11/h5,7-8H,2-4,13H2,1H3,(H2,14,15,16)/t7-,8-/m0/s1 |
| InChIKey | SJQOIXYYJJKJOT-YUMQZZPRSA-N |
| XLogP | -0.06 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone?
The IUPAC name of 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone (CID 118133829) is 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone.
What is the SMILES notation for 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone?
The canonical SMILES for 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone is CC(=O)[C@@H]1CCN(c2ncnc(N)c2F)C[C@@H]1N.
What is the InChIKey of 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone?
The InChIKey is SJQOIXYYJJKJOT-YUMQZZPRSA-N. The full InChI is InChI=1S/C11H16FN5O/c1-6(18)7-2-3-17(4-8(7)13)11-9(12)10(14)15-5-16-11/h5,7-8H,2-4,13H2,1H3,(H2,14,15,16)/t7-,8-/m0/s1.
What are the key properties of 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone?
1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone has a molecular weight of 253.28 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R,4R)-3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]ethanone is sourced from PubChem (CID 118133829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).