C46H43NO — CID 118133911
7,20-ditert-butyl-24-(3-tert-butylphenyl)-3-oxa-24-azaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2(10),4(9),5,7,11,13,15,17(25),18(23),19,21,26(30),27-tetradecaene (PubChem CID 118133911) has the molecular formula C46H43NO and a molecular weight of 625.86 g/mol. Its IUPAC name is 7,20-ditert-butyl-24-(3-tert-butylphenyl)-3-oxa-24-azaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2(10),4(9),5,7,11,13,15,17(25),18(23),19,21,26(30),27-tetradecaene.
| Compound Name | 7,20-ditert-butyl-24-(3-tert-butylphenyl)-3-oxa-24-azaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2(10),4(9),5,7,11,13,15,17(25),18(23),19,21,26(30),27-tetradecaene |
|---|---|
| PubChem CID | 118133911 |
| Molecular Formula | C46H43NO |
| Molecular Weight | 625.86 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | 7,20-ditert-butyl-24-(3-tert-butylphenyl)-3-oxa-24-azaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2(10),4(9),5,7,11,13,15,17(25),18(23),19,21,26(30),27-tetradecaene |
| SMILES | CC(C)(C)c1cccc(-n2c3ccc(C(C)(C)C)cc3c3cc4ccc5cc6c7cc(C(C)(C)C)ccc7oc6c6ccc(c4c56)c32)c1 |
| InChI | InChI=1S/C46H43NO/c1-44(2,3)28-11-10-12-31(23-28)47-38-19-15-29(45(4,5)6)24-34(38)36-21-26-13-14-27-22-37-35-25-30(46(7,8)9)16-20-39(35)48-43(37)33-18-17-32(42(36)47)40(26)41(27)33/h10-25H,1-9H3 |
| InChIKey | ANXVKXWSRYXQJZ-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.86 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|