C32H37NO4Si — CID 11813405
(6S,7S,8E,8aS)-7-[tert-butyl(diphenyl)silyl]oxy-8-ethylidene-6-phenylmethoxy-5,6,7,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 11813405) has the molecular formula C32H37NO4Si and a molecular weight of 527.74 g/mol. Its IUPAC name is (6S,7S,8E,8aS)-7-[tert-butyl(diphenyl)silyl]oxy-8-ethylidene-6-phenylmethoxy-5,6,7,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (6S,7S,8E,8aS)-7-[tert-butyl(diphenyl)silyl]oxy-8-ethylidene-6-phenylmethoxy-5,6,7,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 11813405 |
| Molecular Formula | C32H37NO4Si |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | (6S,7S,8E,8aS)-7-[tert-butyl(diphenyl)silyl]oxy-8-ethylidene-6-phenylmethoxy-5,6,7,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | C/C=C1\[C@H]2COC(=O)N2C[C@H](OCc2ccccc2)[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H37NO4Si/c1-5-27-28-23-36-31(34)33(28)21-29(35-22-24-15-9-6-10-16-24)30(27)37-38(32(2,3)4,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h5-20,28-30H,21-23H2,1-4H3/b27-5+/t28-,29+,30+/m1/s1 |
| InChIKey | ZMUNOINMZDTRMG-DDKMUKDBSA-N |
| XLogP | 5.30 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|