C22H36N4O7SSi — CID 11813418
1-[(5R,6R,8R,9R)-4-amino-6-(azetidin-1-ylmethyl)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione (PubChem CID 11813418) has the molecular formula C22H36N4O7SSi and a molecular weight of 528.70 g/mol. Its IUPAC name is 1-[(5R,6R,8R,9R)-4-amino-6-(azetidin-1-ylmethyl)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione.
| Compound Name | 1-[(5R,6R,8R,9R)-4-amino-6-(azetidin-1-ylmethyl)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11813418 |
| Molecular Formula | C22H36N4O7SSi |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 1-[(5R,6R,8R,9R)-4-amino-6-(azetidin-1-ylmethyl)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](CN3CCC3)[C@@]3(OS(=O)(=O)C=C3N)[C@H]2O[Si](C)(C)C(C)(C)C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C22H36N4O7SSi/c1-14-11-26(20(28)24(5)18(14)27)19-17(32-35(6,7)21(2,3)4)22(15(23)13-34(29,30)33-22)16(31-19)12-25-9-8-10-25/h11,13,16-17,19H,8-10,12,23H2,1-7H3/t16-,17+,19-,22-/m1/s1 |
| InChIKey | OUVTZBTZISIFPB-ZRAXVTTISA-N |
| XLogP | 0.75 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|