C30H47NO7 — CID 11813472
(2S,5S,6R,10R,11S)-5-benzyl-10-heptyl-6-(methoxymethoxy)-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione (PubChem CID 11813472) has the molecular formula C30H47NO7 and a molecular weight of 533.71 g/mol. Its IUPAC name is (2S,5S,6R,10R,11S)-5-benzyl-10-heptyl-6-(methoxymethoxy)-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione.
| Compound Name | (2S,5S,6R,10R,11S)-5-benzyl-10-heptyl-6-(methoxymethoxy)-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |
|---|---|
| PubChem CID | 11813472 |
| Molecular Formula | C30H47NO7 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.34 |
| IUPAC Name | (2S,5S,6R,10R,11S)-5-benzyl-10-heptyl-6-(methoxymethoxy)-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |
| SMILES | CCCCCCC[C@H]1OC(=O)C[C@@H](OCOC)[C@H](Cc2ccccc2)N(C)C(=O)[C@H](C(C)C)OC(=O)[C@H]1C |
| InChI | InChI=1S/C30H47NO7/c1-7-8-9-10-14-17-25-22(4)30(34)38-28(21(2)3)29(33)31(5)24(18-23-15-12-11-13-16-23)26(36-20-35-6)19-27(32)37-25/h11-13,15-16,21-22,24-26,28H,7-10,14,17-20H2,1-6H3/t22-,24-,25+,26+,28-/m0/s1 |
| InChIKey | STAAVYLOHNGUFX-ZNKMBPQTSA-N |
| XLogP | 4.93 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|