C36H48Si2 — CID 11813507
2-[(10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-5-(2-trimethylsilylethynyl)pyren-4-yl]ethynyl-trimethylsilane (PubChem CID 11813507) has the molecular formula C36H48Si2 and a molecular weight of 536.95 g/mol. Its IUPAC name is 2-[(10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-5-(2-trimethylsilylethynyl)pyren-4-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-5-(2-trimethylsilylethynyl)pyren-4-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11813507 |
| Molecular Formula | C36H48Si2 |
| Molecular Weight | 536.95 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 2-[(10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-5-(2-trimethylsilylethynyl)pyren-4-yl]ethynyl-trimethylsilane |
| SMILES | CC(C)(C)C1=CC2=C(C#C[Si](C)(C)C)C(C#C[Si](C)(C)C)=C3C=C(C(C)(C)C)C=C4C=CC(=C1)[C@]2(C)[C@@]43C |
| InChI | InChI=1S/C36H48Si2/c1-33(2,3)27-21-25-15-16-26-22-28(34(4,5)6)24-32-30(18-20-38(12,13)14)29(17-19-37(9,10)11)31(23-27)35(25,7)36(26,32)8/h15-16,21-24H,1-14H3/t35-,36-/m0/s1 |
| InChIKey | VOLYKKZLGKTATM-ZPGRZCPFSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.95 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|