About 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole
6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole (PubChem CID 118135321) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole |
| PubChem CID | 118135321 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole |
| SMILES | CN1NNc2cc(CC(C)(C)C)ccc21 |
| InChI | InChI=1S/C12H19N3/c1-12(2,3)8-9-5-6-11-10(7-9)13-14-15(11)4/h5-7,13-14H,8H2,1-4H3 |
| InChIKey | USMHPQHACGGCIX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole?
The IUPAC name of 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole (CID 118135321) is 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole.
What is the SMILES notation for 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole?
The canonical SMILES for 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole is CN1NNc2cc(CC(C)(C)C)ccc21.
What is the InChIKey of 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole?
The InChIKey is USMHPQHACGGCIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-12(2,3)8-9-5-6-11-10(7-9)13-14-15(11)4/h5-7,13-14H,8H2,1-4H3.
What are the key properties of 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole?
6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole has a molecular weight of 205.31 g/mol, XLogP of 2.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-dimethylpropyl)-3-methyl-1,2-dihydrobenzotriazole is sourced from PubChem (CID 118135321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).