C23H26N2O2 — CID 118135816
(1Z,4E,6E)-1,7-bis[4-(dimethylamino)phenyl]-1-hydroxyhepta-1,4,6-trien-3-one (PubChem CID 118135816) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1Z,4E,6E)-1,7-bis[4-(dimethylamino)phenyl]-1-hydroxyhepta-1,4,6-trien-3-one.
| Compound Name | (1Z,4E,6E)-1,7-bis[4-(dimethylamino)phenyl]-1-hydroxyhepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 118135816 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (1Z,4E,6E)-1,7-bis[4-(dimethylamino)phenyl]-1-hydroxyhepta-1,4,6-trien-3-one |
| SMILES | CN(C)c1ccc(/C=C/C=C/C(=O)/C=C(\O)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H26N2O2/c1-24(2)20-13-9-18(10-14-20)7-5-6-8-22(26)17-23(27)19-11-15-21(16-12-19)25(3)4/h5-17,27H,1-4H3/b7-5+,8-6+,23-17- |
| InChIKey | RIKVJEJWVNONHK-MSHRWFLHSA-N |
| XLogP | 4.56 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|