C29H43O2PS2Si — CID 11813596
[(1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]sulfanyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy-(2-methoxyphenyl)-phenyl-sulfanylidene-lambda5-phosphane (PubChem CID 11813596) has the molecular formula C29H43O2PS2Si and a molecular weight of 546.86 g/mol. Its IUPAC name is [(1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]sulfanyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy-(2-methoxyphenyl)-phenyl-sulfanylidene-lambda5-phosphane.
| Compound Name | [(1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]sulfanyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy-(2-methoxyphenyl)-phenyl-sulfanylidene-lambda5-phosphane |
|---|---|
| PubChem CID | 11813596 |
| Molecular Formula | C29H43O2PS2Si |
| Molecular Weight | 546.86 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [(1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]sulfanyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy-(2-methoxyphenyl)-phenyl-sulfanylidene-lambda5-phosphane |
| SMILES | COc1ccccc1[P@@](=S)(O[C@@H]1[C@H](S[Si](C)(C)C(C)(C)C)[C@H]2CC[C@]1(C)C2(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H43O2PS2Si/c1-27(2,3)35(8,9)34-25-22-19-20-29(6,28(22,4)5)26(25)31-32(33,21-15-11-10-12-16-21)24-18-14-13-17-23(24)30-7/h10-18,22,25-26H,19-20H2,1-9H3/t22-,25-,26-,29+,32-/m1/s1 |
| InChIKey | PGYGWVKOSNGADX-KTIQIETFSA-N |
| XLogP | 7.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.86 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|