C10H6Cl4N2O — CID 118136026
4,5-dichloro-2-[(1Z,3E)-2,4-dichlorohexa-1,3,5-trienyl]pyridazin-3-one (PubChem CID 118136026) has the molecular formula C10H6Cl4N2O and a molecular weight of 311.98 g/mol. Its IUPAC name is 4,5-dichloro-2-[(1Z,3E)-2,4-dichlorohexa-1,3,5-trienyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[(1Z,3E)-2,4-dichlorohexa-1,3,5-trienyl]pyridazin-3-one |
|---|---|
| PubChem CID | 118136026 |
| Molecular Formula | C10H6Cl4N2O |
| Molecular Weight | 311.98 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | 4,5-dichloro-2-[(1Z,3E)-2,4-dichlorohexa-1,3,5-trienyl]pyridazin-3-one |
| SMILES | C=C/C(Cl)=C\C(Cl)=C\n1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H6Cl4N2O/c1-2-6(11)3-7(12)5-16-10(17)9(14)8(13)4-15-16/h2-5H,1H2/b6-3+,7-5- |
| InChIKey | SUGFAXHWVSHMMM-MZECIPTHSA-N |
| XLogP | 3.90 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.98 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|