C19H32O — CID 118136057
[(4aR,8aS)-1,1,4a-trimethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-8a-yl]methanol (PubChem CID 118136057) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is [(4aR,8aS)-1,1,4a-trimethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-8a-yl]methanol.
| Compound Name | [(4aR,8aS)-1,1,4a-trimethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-8a-yl]methanol |
|---|---|
| PubChem CID | 118136057 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | [(4aR,8aS)-1,1,4a-trimethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-8a-yl]methanol |
| SMILES | C=C1CCC2[C@](CO)(CCC3C(C)(C)CCC[C@]32C)C1 |
| InChI | InChI=1S/C19H32O/c1-14-6-7-16-18(4)10-5-9-17(2,3)15(18)8-11-19(16,12-14)13-20/h15-16,20H,1,5-13H2,2-4H3/t15?,16?,18-,19-/m1/s1 |
| InChIKey | WTAUZZGGRSLZCX-LRMJVLKBSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|