C12H7F5O6 — CID 118136173
(5-methyl-2-oxo-1,3-dioxan-5-yl) (2,3,4,5,6-pentafluorophenyl) carbonate (PubChem CID 118136173) has the molecular formula C12H7F5O6 and a molecular weight of 342.17 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxan-5-yl) (2,3,4,5,6-pentafluorophenyl) carbonate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxan-5-yl) (2,3,4,5,6-pentafluorophenyl) carbonate |
|---|---|
| PubChem CID | 118136173 |
| Molecular Formula | C12H7F5O6 |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxan-5-yl) (2,3,4,5,6-pentafluorophenyl) carbonate |
| SMILES | CC1(OC(=O)Oc2c(F)c(F)c(F)c(F)c2F)COC(=O)OC1 |
| InChI | InChI=1S/C12H7F5O6/c1-12(2-20-10(18)21-3-12)23-11(19)22-9-7(16)5(14)4(13)6(15)8(9)17/h2-3H2,1H3 |
| InChIKey | OKCWEBAHEIARKL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|