C23H14F6O4 — CID 118136303
6-[2-(5,8-dioxo-6,7-dihydronaphthalen-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3-dihydronaphthalene-1,4-dione (PubChem CID 118136303) has the molecular formula C23H14F6O4 and a molecular weight of 468.35 g/mol. Its IUPAC name is 6-[2-(5,8-dioxo-6,7-dihydronaphthalen-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3-dihydronaphthalene-1,4-dione.
| Compound Name | 6-[2-(5,8-dioxo-6,7-dihydronaphthalen-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 118136303 |
| Molecular Formula | C23H14F6O4 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 6-[2-(5,8-dioxo-6,7-dihydronaphthalen-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3-dihydronaphthalene-1,4-dione |
| SMILES | O=C1CCC(=O)c2cc(C(c3ccc4c(c3)C(=O)CCC4=O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C23H14F6O4/c24-22(25,26)21(23(27,28)29,11-1-3-13-15(9-11)19(32)7-5-17(13)30)12-2-4-14-16(10-12)20(33)8-6-18(14)31/h1-4,9-10H,5-8H2 |
| InChIKey | NLHBZNSXCMIPOR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|