C11H15F3N4O2 — CID 118136374
ethyl 2-[5-methyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]acetate (PubChem CID 118136374) has the molecular formula C11H15F3N4O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is ethyl 2-[5-methyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]acetate.
| Compound Name | ethyl 2-[5-methyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]acetate |
|---|---|
| PubChem CID | 118136374 |
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | ethyl 2-[5-methyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]acetate |
| SMILES | CCOC(=O)CC1NCC(C)n2c1nnc2C(F)(F)F |
| InChI | InChI=1S/C11H15F3N4O2/c1-3-20-8(19)4-7-9-16-17-10(11(12,13)14)18(9)6(2)5-15-7/h6-7,15H,3-5H2,1-2H3 |
| InChIKey | INNJOFIAQOPVRC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |