C7H9F3N4O — CID 118136391
5-Methoxy-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 118136391) has the molecular formula C7H9F3N4O and a molecular weight of 222.17 g/mol. Its IUPAC name is 5-methoxy-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 5-Methoxy-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 118136391 |
| Molecular Formula | C7H9F3N4O |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 5-methoxy-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | COC1CNCC2=NN=C(N12)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N4O/c1-15-5-3-11-2-4-12-13-6(14(4)5)7(8,9)10/h5,11H,2-3H2,1H3 |
| InChIKey | OYCBBUCKPDKQRY-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | 237 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |