C8H11F3N4O — CID 118136394
5-methoxy-8-methyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 118136394) has the molecular formula C8H11F3N4O and a molecular weight of 236.20 g/mol. Its IUPAC name is 5-methoxy-8-methyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 5-methoxy-8-methyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 118136394 |
| Molecular Formula | C8H11F3N4O |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 5-methoxy-8-methyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | COC1CNC(C)c2nnc(C(F)(F)F)n21 |
| InChI | InChI=1S/C8H11F3N4O/c1-4-6-13-14-7(8(9,10)11)15(6)5(16-2)3-12-4/h4-5,12H,3H2,1-2H3 |
| InChIKey | UQOGGMVPAQFAMJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |