About 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane
3-methyl-8-oxa-2,3-diazaspiro[4.5]decane (PubChem CID 118136765) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane |
| PubChem CID | 118136765 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane |
| SMILES | CN1CC2(CCOCC2)CN1 |
| InChI | InChI=1S/C8H16N2O/c1-10-7-8(6-9-10)2-4-11-5-3-8/h9H,2-7H2,1H3 |
| InChIKey | WVCNOTACVJHDPO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane?
The IUPAC name of 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane (CID 118136765) is 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane.
What is the SMILES notation for 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane?
The canonical SMILES for 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane is CN1CC2(CCOCC2)CN1.
What is the InChIKey of 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane?
The InChIKey is WVCNOTACVJHDPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-10-7-8(6-9-10)2-4-11-5-3-8/h9H,2-7H2,1H3.
What are the key properties of 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane?
3-methyl-8-oxa-2,3-diazaspiro[4.5]decane has a molecular weight of 156.23 g/mol, XLogP of 0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-8-oxa-2,3-diazaspiro[4.5]decane is sourced from PubChem (CID 118136765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).