C69H87N3O6 — CID 118136810
1-[(2,4-ditert-butyl-3-phenylmethoxyphenyl)methyl]-3,5-bis[(3,5-ditert-butyl-4-phenylmethoxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 118136810) has the molecular formula C69H87N3O6 and a molecular weight of 1054.47 g/mol. Its IUPAC name is 1-[(2,4-ditert-butyl-3-phenylmethoxyphenyl)methyl]-3,5-bis[(3,5-ditert-butyl-4-phenylmethoxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(2,4-ditert-butyl-3-phenylmethoxyphenyl)methyl]-3,5-bis[(3,5-ditert-butyl-4-phenylmethoxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 118136810 |
| Molecular Formula | C69H87N3O6 |
| Molecular Weight | 1054.47 g/mol |
| Exact Mass | 1053.66 |
| IUPAC Name | 1-[(2,4-ditert-butyl-3-phenylmethoxyphenyl)methyl]-3,5-bis[(3,5-ditert-butyl-4-phenylmethoxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC(C)(C)c1cc(Cn2c(=O)n(Cc3cc(C(C)(C)C)c(OCc4ccccc4)c(C(C)(C)C)c3)c(=O)n(Cc3ccc(C(C)(C)C)c(OCc4ccccc4)c3C(C)(C)C)c2=O)cc(C(C)(C)C)c1OCc1ccccc1 |
| InChI | InChI=1S/C69H87N3O6/c1-64(2,3)52-35-34-51(57(69(16,17)18)60(52)78-45-48-32-26-21-27-33-48)42-72-62(74)70(40-49-36-53(65(4,5)6)58(54(37-49)66(7,8)9)76-43-46-28-22-19-23-29-46)61(73)71(63(72)75)41-50-38-55(67(10,11)12)59(56(39-50)68(13,14)15)77-44-47-30-24-20-25-31-47/h19-39H,40-45H2,1-18H3 |
| InChIKey | YYAYRJUFTOOBJG-UHFFFAOYSA-N |
| XLogP | 14.84 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.47 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |