C27H40O9 — CID 118136875
1-[(1S,4S,5R,7S,8S,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S,5S)-5-methyl-4-methylideneoxolan-2-yl]butan-2-one (PubChem CID 118136875) has the molecular formula C27H40O9 and a molecular weight of 508.61 g/mol. Its IUPAC name is 1-[(1S,4S,5R,7S,8S,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S,5S)-5-methyl-4-methylideneoxolan-2-yl]butan-2-one.
| Compound Name | 1-[(1S,4S,5R,7S,8S,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S,5S)-5-methyl-4-methylideneoxolan-2-yl]butan-2-one |
|---|---|
| PubChem CID | 118136875 |
| Molecular Formula | C27H40O9 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 1-[(1S,4S,5R,7S,8S,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S,5S)-5-methyl-4-methylideneoxolan-2-yl]butan-2-one |
| SMILES | C=C1C[C@H](CCC(=O)C[C@H]2O[C@@H]3C(O[C@H]4CC[C@H](CC(=O)C[C@@H]5CCOC5)OC4[C@@H]3O)[C@H]2O)O[C@H]1C |
| InChI | InChI=1S/C27H40O9/c1-14-9-19(33-15(14)2)4-3-17(28)12-22-23(30)26-27(36-22)24(31)25-21(35-26)6-5-20(34-25)11-18(29)10-16-7-8-32-13-16/h15-16,19-27,30-31H,1,3-13H2,2H3/t15-,16-,19-,20+,21-,22+,23-,24-,25?,26?,27-/m0/s1 |
| InChIKey | ZCMVTFZSRUHABG-WJVWUAAGSA-N |
| XLogP | 1.65 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|