C27H47NO9Si — CID 11813689
tert-butyl (Z,6R,7S)-6-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-2-cyano-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-(methoxymethoxy)hept-4-enoate (PubChem CID 11813689) has the molecular formula C27H47NO9Si and a molecular weight of 557.76 g/mol. Its IUPAC name is tert-butyl (Z,6R,7S)-6-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-2-cyano-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-(methoxymethoxy)hept-4-enoate.
| Compound Name | tert-butyl (Z,6R,7S)-6-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-2-cyano-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-(methoxymethoxy)hept-4-enoate |
|---|---|
| PubChem CID | 11813689 |
| Molecular Formula | C27H47NO9Si |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | tert-butyl (Z,6R,7S)-6-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-2-cyano-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-(methoxymethoxy)hept-4-enoate |
| SMILES | COCO[C@@H]([C@@H](/C=C\CC(C#N)(O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C)OC(C)=O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C27H47NO9Si/c1-19(29)34-20(22(32-18-31-10)21-16-33-26(8,9)35-21)14-13-15-27(17-28,23(30)36-24(2,3)4)37-38(11,12)25(5,6)7/h13-14,20-22H,15-16,18H2,1-12H3/b14-13-/t20-,21-,22+,27?/m1/s1 |
| InChIKey | DNHZPNGOHYWRPW-YHECYOJESA-N |
| XLogP | 4.63 |
| TPSA | 122.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|