About N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide
N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide (PubChem CID 118136911) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide.
Molecular Properties
| Compound Name | N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide |
| PubChem CID | 118136911 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide |
| SMILES | CC(=O)NC1[C@H]2CNCN(C2)C[C@H]1C |
| InChI | InChI=1S/C10H19N3O/c1-7-4-13-5-9(3-11-6-13)10(7)12-8(2)14/h7,9-11H,3-6H2,1-2H3,(H,12,14)/t7-,9+,10?/m1/s1 |
| InChIKey | VSJMCHDEBKYPQE-IKZKJGMZSA-N |
| XLogP | -0.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide?
The IUPAC name of N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide (CID 118136911) is N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide.
What is the SMILES notation for N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide?
The canonical SMILES for N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide is CC(=O)NC1[C@H]2CNCN(C2)C[C@H]1C.
What is the InChIKey of N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide?
The InChIKey is VSJMCHDEBKYPQE-IKZKJGMZSA-N. The full InChI is InChI=1S/C10H19N3O/c1-7-4-13-5-9(3-11-6-13)10(7)12-8(2)14/h7,9-11H,3-6H2,1-2H3,(H,12,14)/t7-,9+,10?/m1/s1.
What are the key properties of N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide?
N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide has a molecular weight of 197.28 g/mol, XLogP of -0.38, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5S,7R)-7-methyl-1,3-diazabicyclo[3.3.1]nonan-6-yl]acetamide is sourced from PubChem (CID 118136911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).