C26H38O9 — CID 118136921
1-[(1S,4S,5R,7S,8S,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S)-4-methylideneoxolan-2-yl]butan-2-one (PubChem CID 118136921) has the molecular formula C26H38O9 and a molecular weight of 494.58 g/mol. Its IUPAC name is 1-[(1S,4S,5R,7S,8S,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S)-4-methylideneoxolan-2-yl]butan-2-one.
| Compound Name | 1-[(1S,4S,5R,7S,8S,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S)-4-methylideneoxolan-2-yl]butan-2-one |
|---|---|
| PubChem CID | 118136921 |
| Molecular Formula | C26H38O9 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 1-[(1S,4S,5R,7S,8S,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S)-4-methylideneoxolan-2-yl]butan-2-one |
| SMILES | C=C1CO[C@@H](CCC(=O)C[C@H]2O[C@@H]3C(O[C@H]4CC[C@H](CC(=O)C[C@@H]5CCOC5)OC4[C@@H]3O)[C@H]2O)C1 |
| InChI | InChI=1S/C26H38O9/c1-14-8-18(32-12-14)3-2-16(27)11-21-22(29)25-26(35-21)23(30)24-20(34-25)5-4-19(33-24)10-17(28)9-15-6-7-31-13-15/h15,18-26,29-30H,1-13H2/t15-,18-,19+,20-,21+,22-,23-,24?,25?,26-/m0/s1 |
| InChIKey | HJUJVSOEOGJMDD-LEWAKKJESA-N |
| XLogP | 1.26 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|