About 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone
1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 118137096) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone |
| PubChem CID | 118137096 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | CCCCOC1=CC=C(C(C)=O)CC1 |
| InChI | InChI=1S/C12H18O2/c1-3-4-9-14-12-7-5-11(6-8-12)10(2)13/h5,7H,3-4,6,8-9H2,1-2H3 |
| InChIKey | SUAJWTKEAAOPOS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone?
The IUPAC name of 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone (CID 118137096) is 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone.
What is the SMILES notation for 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone?
The canonical SMILES for 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone is CCCCOC1=CC=C(C(C)=O)CC1.
What is the InChIKey of 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone?
The InChIKey is SUAJWTKEAAOPOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-3-4-9-14-12-7-5-11(6-8-12)10(2)13/h5,7H,3-4,6,8-9H2,1-2H3.
What are the key properties of 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone?
1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone has a molecular weight of 194.27 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-butoxycyclohexa-1,3-dien-1-yl)ethanone is sourced from PubChem (CID 118137096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).