C28H28N6O4 — CID 118137573
ethyl 6-[4-[1-(azidomethyl)cyclopropyl]phenyl]-1-(4-methoxyphenyl)-7-oxospiro[5H-pyrazolo[5,4-c]pyridine-4,1'-cyclopropane]-3-carboxylate (PubChem CID 118137573) has the molecular formula C28H28N6O4 and a molecular weight of 512.57 g/mol. Its IUPAC name is ethyl 6-[4-[1-(azidomethyl)cyclopropyl]phenyl]-1-(4-methoxyphenyl)-7-oxospiro[5H-pyrazolo[5,4-c]pyridine-4,1'-cyclopropane]-3-carboxylate.
| Compound Name | ethyl 6-[4-[1-(azidomethyl)cyclopropyl]phenyl]-1-(4-methoxyphenyl)-7-oxospiro[5H-pyrazolo[5,4-c]pyridine-4,1'-cyclopropane]-3-carboxylate |
|---|---|
| PubChem CID | 118137573 |
| Molecular Formula | C28H28N6O4 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | ethyl 6-[4-[1-(azidomethyl)cyclopropyl]phenyl]-1-(4-methoxyphenyl)-7-oxospiro[5H-pyrazolo[5,4-c]pyridine-4,1'-cyclopropane]-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(OC)cc2)c2c1C1(CC1)CN(c1ccc(C3(CN=[N+]=[N-])CC3)cc1)C2=O |
| InChI | InChI=1S/C28H28N6O4/c1-3-38-26(36)23-22-24(34(31-23)20-8-10-21(37-2)11-9-20)25(35)33(17-28(22)14-15-28)19-6-4-18(5-7-19)27(12-13-27)16-30-32-29/h4-11H,3,12-17H2,1-2H3 |
| InChIKey | ZHQFOFIAJZODJG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|