C23H23NO5S — CID 118137861
4-ethylsulfonyl-22-methyl-8,18-dioxa-22-azatetracyclo[17.4.0.02,7.09,14]tricosa-1(23),2(7),3,5,9,11,13,19-octaen-21-one (PubChem CID 118137861) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is 4-ethylsulfonyl-22-methyl-8,18-dioxa-22-azatetracyclo[17.4.0.02,7.09,14]tricosa-1(23),2(7),3,5,9,11,13,19-octaen-21-one.
| Compound Name | 4-ethylsulfonyl-22-methyl-8,18-dioxa-22-azatetracyclo[17.4.0.02,7.09,14]tricosa-1(23),2(7),3,5,9,11,13,19-octaen-21-one |
|---|---|
| PubChem CID | 118137861 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 4-ethylsulfonyl-22-methyl-8,18-dioxa-22-azatetracyclo[17.4.0.02,7.09,14]tricosa-1(23),2(7),3,5,9,11,13,19-octaen-21-one |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)-c1cn(C)c(=O)cc1OCCCc1ccccc1O2 |
| InChI | InChI=1S/C23H23NO5S/c1-3-30(26,27)17-10-11-21-18(13-17)19-15-24(2)23(25)14-22(19)28-12-6-8-16-7-4-5-9-20(16)29-21/h4-5,7,9-11,13-15H,3,6,8,12H2,1-2H3 |
| InChIKey | AGVMOISFBMDLSM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |