C22H21NO5S — CID 118137879
4-ethylsulfonyl-21-methyl-8,17-dioxa-21-azatetracyclo[16.4.0.02,7.09,14]docosa-1(22),2(7),3,5,9,11,13,18-octaen-20-one (PubChem CID 118137879) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is 4-ethylsulfonyl-21-methyl-8,17-dioxa-21-azatetracyclo[16.4.0.02,7.09,14]docosa-1(22),2(7),3,5,9,11,13,18-octaen-20-one.
| Compound Name | 4-ethylsulfonyl-21-methyl-8,17-dioxa-21-azatetracyclo[16.4.0.02,7.09,14]docosa-1(22),2(7),3,5,9,11,13,18-octaen-20-one |
|---|---|
| PubChem CID | 118137879 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 4-ethylsulfonyl-21-methyl-8,17-dioxa-21-azatetracyclo[16.4.0.02,7.09,14]docosa-1(22),2(7),3,5,9,11,13,18-octaen-20-one |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)-c1cn(C)c(=O)cc1OCCc1ccccc1O2 |
| InChI | InChI=1S/C22H21NO5S/c1-3-29(25,26)16-8-9-20-17(12-16)18-14-23(2)22(24)13-21(18)27-11-10-15-6-4-5-7-19(15)28-20/h4-9,12-14H,3,10-11H2,1-2H3 |
| InChIKey | PSZPPDUGQXQAJP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |