C40H27NO3 — CID 11813800
(1S,16R,17R,21S)-19-(3-methylphenyl)-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione (PubChem CID 11813800) has the molecular formula C40H27NO3 and a molecular weight of 569.66 g/mol. Its IUPAC name is (1S,16R,17R,21S)-19-(3-methylphenyl)-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione.
| Compound Name | (1S,16R,17R,21S)-19-(3-methylphenyl)-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione |
|---|---|
| PubChem CID | 11813800 |
| Molecular Formula | C40H27NO3 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | (1S,16R,17R,21S)-19-(3-methylphenyl)-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione |
| SMILES | Cc1cccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@]2(c4ccccc4)C(=O)[C@]3(c3ccccc3)c3c2c2ccccc2c2ccccc32)c1 |
| InChI | InChI=1S/C40H27NO3/c1-24-13-12-18-27(23-24)41-36(42)34-35(37(41)43)40(26-16-6-3-7-17-26)33-31-22-11-9-20-29(31)28-19-8-10-21-30(28)32(33)39(34,38(40)44)25-14-4-2-5-15-25/h2-23,34-35H,1H3/t34-,35+,39+,40- |
| InChIKey | MYSIJWJTCAEZQS-DFEXOLERSA-N |
| XLogP | 7.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|