C17H15NO4S2 — CID 118138036
4-cyano-3-(3-methoxycarbonylphenyl)-5-propan-2-ylsulfanylthiophene-2-carboxylic acid (PubChem CID 118138036) has the molecular formula C17H15NO4S2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-cyano-3-(3-methoxycarbonylphenyl)-5-propan-2-ylsulfanylthiophene-2-carboxylic acid.
| Compound Name | 4-cyano-3-(3-methoxycarbonylphenyl)-5-propan-2-ylsulfanylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 118138036 |
| Molecular Formula | C17H15NO4S2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 4-cyano-3-(3-methoxycarbonylphenyl)-5-propan-2-ylsulfanylthiophene-2-carboxylic acid |
| SMILES | COC(=O)c1cccc(-c2c(C(=O)O)sc(SC(C)C)c2C#N)c1 |
| InChI | InChI=1S/C17H15NO4S2/c1-9(2)23-17-12(8-18)13(14(24-17)15(19)20)10-5-4-6-11(7-10)16(21)22-3/h4-7,9H,1-3H3,(H,19,20) |
| InChIKey | QRIOULZPYXDQKY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |