C6H5F7O2 — CID 118138220
3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]prop-1-ene (PubChem CID 118138220) has the molecular formula C6H5F7O2 and a molecular weight of 242.09 g/mol. Its IUPAC name is 3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]prop-1-ene.
| Compound Name | 3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]prop-1-ene |
|---|---|
| PubChem CID | 118138220 |
| Molecular Formula | C6H5F7O2 |
| Molecular Weight | 242.09 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]prop-1-ene |
| SMILES | C=CCOC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C6H5F7O2/c1-2-3-14-4(7,8)5(9,10)15-6(11,12)13/h2H,1,3H2 |
| InChIKey | PMTHFKKCIILRBI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|