C9H12F6O2 — CID 118138316
1,1,1,2,3,3-hexafluoro-3-prop-2-enoxy-2-propoxypropane (PubChem CID 118138316) has the molecular formula C9H12F6O2 and a molecular weight of 266.18 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-prop-2-enoxy-2-propoxypropane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-prop-2-enoxy-2-propoxypropane |
|---|---|
| PubChem CID | 118138316 |
| Molecular Formula | C9H12F6O2 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-prop-2-enoxy-2-propoxypropane |
| SMILES | C=CCOC(F)(F)C(F)(OCCC)C(F)(F)F |
| InChI | InChI=1S/C9H12F6O2/c1-3-5-16-7(10,8(11,12)13)9(14,15)17-6-4-2/h4H,2-3,5-6H2,1H3 |
| InChIKey | PBLNJHHBKMGBRB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|