C25H33N5O3 — CID 118138643
(2S)-2-amino-3-[4-[[N'-[[2-(3,5-dimethylpiperidin-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 118138643) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[[N'-[[2-(3,5-dimethylpiperidin-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[[N'-[[2-(3,5-dimethylpiperidin-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118138643 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | (2S)-2-amino-3-[4-[[N'-[[2-(3,5-dimethylpiperidin-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | CC1CC(C)CN(c2ccccc2C/N=C(\N)NC(=O)c2ccc(C[C@H](N)C(=O)O)cc2)C1 |
| InChI | InChI=1S/C25H33N5O3/c1-16-11-17(2)15-30(14-16)22-6-4-3-5-20(22)13-28-25(27)29-23(31)19-9-7-18(8-10-19)12-21(26)24(32)33/h3-10,16-17,21H,11-15,26H2,1-2H3,(H,32,33)(H3,27,28,29,31)/t16?,17?,21-/m0/s1 |
| InChIKey | KHBXAOMQJPOSSQ-BPZDKFOGSA-N |
| XLogP | 2.37 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|