C37H43NOP2 — CID 11813887
2-[[(1S,2S,3S,4R)-2,3-bis(diphenylphosphanyl)-7-bicyclo[2.2.1]heptanyl]oxy]-N,N-diethylethanamine (PubChem CID 11813887) has the molecular formula C37H43NOP2 and a molecular weight of 579.70 g/mol. Its IUPAC name is 2-[[(1S,2S,3S,4R)-2,3-bis(diphenylphosphanyl)-7-bicyclo[2.2.1]heptanyl]oxy]-N,N-diethylethanamine.
| Compound Name | 2-[[(1S,2S,3S,4R)-2,3-bis(diphenylphosphanyl)-7-bicyclo[2.2.1]heptanyl]oxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 11813887 |
| Molecular Formula | C37H43NOP2 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | 2-[[(1S,2S,3S,4R)-2,3-bis(diphenylphosphanyl)-7-bicyclo[2.2.1]heptanyl]oxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOC1[C@H]2CC[C@@H]1[C@H](P(c1ccccc1)c1ccccc1)[C@H]2P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H43NOP2/c1-3-38(4-2)27-28-39-35-33-25-26-34(35)37(41(31-21-13-7-14-22-31)32-23-15-8-16-24-32)36(33)40(29-17-9-5-10-18-29)30-19-11-6-12-20-30/h5-24,33-37H,3-4,25-28H2,1-2H3/t33-,34+,35?,36-,37-/m0/s1 |
| InChIKey | KZWJOGBGMFMRFQ-GEVCCZPDSA-N |
| XLogP | 6.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|