C33H44O3S2Si — CID 11813902
(2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-6-phenylmethoxyhexan-2-ol (PubChem CID 11813902) has the molecular formula C33H44O3S2Si and a molecular weight of 580.93 g/mol. Its IUPAC name is (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-6-phenylmethoxyhexan-2-ol.
| Compound Name | (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-6-phenylmethoxyhexan-2-ol |
|---|---|
| PubChem CID | 11813902 |
| Molecular Formula | C33H44O3S2Si |
| Molecular Weight | 580.93 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-6-phenylmethoxyhexan-2-ol |
| SMILES | CC(C)(C)[Si](O[C@@H](CCOCc1ccccc1)C[C@H](O)CC1SCCCS1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H44O3S2Si/c1-33(2,3)39(30-16-9-5-10-17-30,31-18-11-6-12-19-31)36-29(20-21-35-26-27-14-7-4-8-15-27)24-28(34)25-32-37-22-13-23-38-32/h4-12,14-19,28-29,32,34H,13,20-26H2,1-3H3/t28-,29-/m0/s1 |
| InChIKey | ONQDWCDDXKFRFM-VMPREFPWSA-N |
| XLogP | 6.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.93 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|