C28H30N8OS — CID 118139027
2-tert-butyl-N-[[2-methyl-4-[6-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]-1,3-thiazole-5-carboxamide (PubChem CID 118139027) has the molecular formula C28H30N8OS and a molecular weight of 526.67 g/mol. Its IUPAC name is 2-tert-butyl-N-[[2-methyl-4-[6-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[[2-methyl-4-[6-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 118139027 |
| Molecular Formula | C28H30N8OS |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 2-tert-butyl-N-[[2-methyl-4-[6-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(-c2ncnc3[nH]c(-c4cnn5c4CNCC5)cc23)ccc1CNC(=O)c1cnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C28H30N8OS/c1-16-9-17(5-6-18(16)11-30-26(37)23-14-31-27(38-23)28(2,3)4)24-19-10-21(35-25(19)33-15-32-24)20-12-34-36-8-7-29-13-22(20)36/h5-6,9-10,12,14-15,29H,7-8,11,13H2,1-4H3,(H,30,37)(H,32,33,35) |
| InChIKey | CAPVSWKSXQNHLY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |