C23H24N4OS — CID 118139139
N-[6-(2-aminopyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 118139139) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is N-[6-(2-aminopyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[6-(2-aminopyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 118139139 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[6-(2-aminopyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | Nc1nccc(-c2ccc3c(c2)CCCC3NC(=O)c2cc3c(s2)CCCC3)n1 |
| InChI | InChI=1S/C23H24N4OS/c24-23-25-11-10-18(27-23)15-8-9-17-14(12-15)5-3-6-19(17)26-22(28)21-13-16-4-1-2-7-20(16)29-21/h8-13,19H,1-7H2,(H,26,28)(H2,24,25,27) |
| InChIKey | YOJYYTVLQHVMEF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |