C28H35F3N8O — CID 118139468
3-tert-butyl-N-[[4-[2-[[1-[(3R)-pyrrolidin-3-yl]pyrazol-4-yl]amino]pyrimidin-4-yl]-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-1-carboxamide (PubChem CID 118139468) has the molecular formula C28H35F3N8O and a molecular weight of 556.64 g/mol. Its IUPAC name is 3-tert-butyl-N-[[4-[2-[[1-[(3R)-pyrrolidin-3-yl]pyrazol-4-yl]amino]pyrimidin-4-yl]-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-tert-butyl-N-[[4-[2-[[1-[(3R)-pyrrolidin-3-yl]pyrazol-4-yl]amino]pyrimidin-4-yl]-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 118139468 |
| Molecular Formula | C28H35F3N8O |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 3-tert-butyl-N-[[4-[2-[[1-[(3R)-pyrrolidin-3-yl]pyrazol-4-yl]amino]pyrimidin-4-yl]-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-1-carboxamide |
| SMILES | CC(C)(C)C1CCN(C(=O)NCc2ccc(-c3ccnc(Nc4cnn([C@@H]5CCNC5)c4)n3)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C28H35F3N8O/c1-27(2,3)20-8-11-38(16-20)26(40)34-13-19-5-4-18(12-23(19)28(29,30)31)24-7-10-33-25(37-24)36-21-14-35-39(17-21)22-6-9-32-15-22/h4-5,7,10,12,14,17,20,22,32H,6,8-9,11,13,15-16H2,1-3H3,(H,34,40)(H,33,36,37)/t20?,22-/m1/s1 |
| InChIKey | KELGLVDBNYKPBL-LWMIZPGFSA-N |
| XLogP | 5.21 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |