C20H23ClN6O2 — CID 118139517
tert-butyl N-chloro-N-[[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]phenyl]methyl]carbamate (PubChem CID 118139517) has the molecular formula C20H23ClN6O2 and a molecular weight of 414.90 g/mol. Its IUPAC name is tert-butyl N-chloro-N-[[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-chloro-N-[[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 118139517 |
| Molecular Formula | C20H23ClN6O2 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | tert-butyl N-chloro-N-[[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]phenyl]methyl]carbamate |
| SMILES | Cn1cc(Nc2nccc(-c3ccc(CN(Cl)C(=O)OC(C)(C)C)cc3)n2)cn1 |
| InChI | InChI=1S/C20H23ClN6O2/c1-20(2,3)29-19(28)27(21)12-14-5-7-15(8-6-14)17-9-10-22-18(25-17)24-16-11-23-26(4)13-16/h5-11,13H,12H2,1-4H3,(H,22,24,25) |
| InChIKey | VAABSXZWNQDQMF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|