C33H43F3N8O3 — CID 118139807
tert-butyl (3S)-3-[4-[[4-[4-[[(3-tert-butylpyrrolidine-1-carbonyl)amino]methyl]-3-(trifluoromethyl)phenyl]pyrimidin-2-yl]amino]pyrazol-1-yl]pyrrolidine-1-carboxylate (PubChem CID 118139807) has the molecular formula C33H43F3N8O3 and a molecular weight of 656.75 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-[[4-[4-[[(3-tert-butylpyrrolidine-1-carbonyl)amino]methyl]-3-(trifluoromethyl)phenyl]pyrimidin-2-yl]amino]pyrazol-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[4-[[4-[4-[[(3-tert-butylpyrrolidine-1-carbonyl)amino]methyl]-3-(trifluoromethyl)phenyl]pyrimidin-2-yl]amino]pyrazol-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118139807 |
| Molecular Formula | C33H43F3N8O3 |
| Molecular Weight | 656.75 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | tert-butyl (3S)-3-[4-[[4-[4-[[(3-tert-butylpyrrolidine-1-carbonyl)amino]methyl]-3-(trifluoromethyl)phenyl]pyrimidin-2-yl]amino]pyrazol-1-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](n2cc(Nc3nccc(-c4ccc(CNC(=O)N5CCC(C(C)(C)C)C5)c(C(F)(F)F)c4)n3)cn2)C1 |
| InChI | InChI=1S/C33H43F3N8O3/c1-31(2,3)23-10-13-42(18-23)29(45)38-16-22-8-7-21(15-26(22)33(34,35)36)27-9-12-37-28(41-27)40-24-17-39-44(19-24)25-11-14-43(20-25)30(46)47-32(4,5)6/h7-9,12,15,17,19,23,25H,10-11,13-14,16,18,20H2,1-6H3,(H,38,45)(H,37,40,41)/t23?,25-/m0/s1 |
| InChIKey | WREZSVRVFRRPAM-YNMFNDETSA-N |
| XLogP | 6.86 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.75 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |