methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate

C12H13N3O3 — CID 118139932

IUPACmethyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate
SMILESCOC(=O)c1cccn(-c2cc(C)n(C)n2)c1=O
InChIInChI=1S/C12H13N3O3/c1-8-7-10(13-14(8)2)15-6-4-5-9(11(15)16)12(17)18-3/h4-7H,1-3H3
InChIKeyJAXKBKXDVNOELU-UHFFFAOYSA-N
MW247.25 g/mol
LogP0.67
Rot. Bonds2

About methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate

methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate (PubChem CID 118139932) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate
PubChem CID118139932
Molecular FormulaC12H13N3O3
Molecular Weight247.25 g/mol
Exact Mass247.10
IUPAC Namemethyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate
SMILESCOC(=O)c1cccn(-c2cc(C)n(C)n2)c1=O
InChIInChI=1S/C12H13N3O3/c1-8-7-10(13-14(8)2)15-6-4-5-9(11(15)16)12(17)18-3/h4-7H,1-3H3
InChIKeyJAXKBKXDVNOELU-UHFFFAOYSA-N
XLogP0.67
TPSA66.12 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.25
LogP ≤ 50.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate?
The IUPAC name of methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate (CID 118139932) is methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate.
What is the SMILES notation for methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate?
The canonical SMILES for methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate is COC(=O)c1cccn(-c2cc(C)n(C)n2)c1=O.
What is the InChIKey of methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate?
The InChIKey is JAXKBKXDVNOELU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3/c1-8-7-10(13-14(8)2)15-6-4-5-9(11(15)16)12(17)18-3/h4-7H,1-3H3.
What are the key properties of methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate?
methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate has a molecular weight of 247.25 g/mol, XLogP of 0.67, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(1,5-dimethylpyrazol-3-yl)-2-oxopyridine-3-carboxylate is sourced from PubChem (CID 118139932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).