About diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate
diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate (PubChem CID 118140174) has the molecular formula C24H20ClFN2O6
and a molecular weight of 486.88 g/mol. Its IUPAC name is diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate |
| PubChem CID | 118140174 |
| Molecular Formula | C24H20ClFN2O6 |
| Molecular Weight | 486.88 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(-c2cccc(OC)c2F)c2c([nH]c1=O)c1cc(Cl)ccc1n2C(=O)OCC |
| InChI | InChI=1S/C24H20ClFN2O6/c1-4-33-23(30)18-17(13-7-6-8-16(32-3)19(13)26)21-20(27-22(18)29)14-11-12(25)9-10-15(14)28(21)24(31)34-5-2/h6-11H,4-5H2,1-3H3,(H,27,29) |
| InChIKey | NSIYDTQSACUYCY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.88 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate?
The IUPAC name of diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate (CID 118140174) is diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate.
What is the SMILES notation for diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate?
The canonical SMILES for diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate is CCOC(=O)c1c(-c2cccc(OC)c2F)c2c([nH]c1=O)c1cc(Cl)ccc1n2C(=O)OCC.
What is the InChIKey of diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate?
The InChIKey is NSIYDTQSACUYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20ClFN2O6/c1-4-33-23(30)18-17(13-7-6-8-16(32-3)19(13)26)21-20(27-22(18)29)14-11-12(25)9-10-15(14)28(21)24(31)34-5-2/h6-11H,4-5H2,1-3H3,(H,27,29).
What are the key properties of diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate?
diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate has a molecular weight of 486.88 g/mol, XLogP of 5.13, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 8-chloro-4-(2-fluoro-3-methoxyphenyl)-2-oxo-1H-pyrido[3,2-b]indole-3,5-dicarboxylate is sourced from PubChem (CID 118140174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).