About (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol
(4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol (PubChem CID 118140301) has the molecular formula C8H7ClN2O
and a molecular weight of 182.61 g/mol. Its IUPAC name is (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol.
Molecular Properties
| Compound Name | (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol |
| PubChem CID | 118140301 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol |
| SMILES | OCc1cc2c(Cl)nccc2[nH]1 |
| InChI | InChI=1S/C8H7ClN2O/c9-8-6-3-5(4-12)11-7(6)1-2-10-8/h1-3,11-12H,4H2 |
| InChIKey | RRQYAQZKRFQLBO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol?
The IUPAC name of (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol (CID 118140301) is (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol.
What is the SMILES notation for (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol?
The canonical SMILES for (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol is OCc1cc2c(Cl)nccc2[nH]1.
What is the InChIKey of (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol?
The InChIKey is RRQYAQZKRFQLBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O/c9-8-6-3-5(4-12)11-7(6)1-2-10-8/h1-3,11-12H,4H2.
What are the key properties of (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol?
(4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol has a molecular weight of 182.61 g/mol, XLogP of 1.71, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-1H-pyrrolo[3,2-c]pyridin-2-yl)methanol is sourced from PubChem (CID 118140301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).