C32H29ClN3O5P — CID 11814042
(6-morpholin-4-yl-2-phenylpyrimidin-4-yl)-triphenylphosphanium perchlorate (PubChem CID 11814042) has the molecular formula C32H29ClN3O5P and a molecular weight of 602.03 g/mol. Its IUPAC name is (6-morpholin-4-yl-2-phenylpyrimidin-4-yl)-triphenylphosphanium perchlorate.
| Compound Name | (6-morpholin-4-yl-2-phenylpyrimidin-4-yl)-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 11814042 |
| Molecular Formula | C32H29ClN3O5P |
| Molecular Weight | 602.03 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | (6-morpholin-4-yl-2-phenylpyrimidin-4-yl)-triphenylphosphanium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2nc(N3CCOCC3)cc([P+](c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C32H29N3OP.ClHO4/c1-5-13-26(14-6-1)32-33-30(35-21-23-36-24-22-35)25-31(34-32)37(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29;2-1(3,4)5/h1-20,25H,21-24H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | DPLIIEDKZQERDB-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 130.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.03 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|