C8H7F5N2O3 — CID 118141426
3-oxo-2-(3,3,4,4,4-pentafluorobutyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 118141426) has the molecular formula C8H7F5N2O3 and a molecular weight of 274.14 g/mol. Its IUPAC name is 3-oxo-2-(3,3,4,4,4-pentafluorobutyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-oxo-2-(3,3,4,4,4-pentafluorobutyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 118141426 |
| Molecular Formula | C8H7F5N2O3 |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 3-oxo-2-(3,3,4,4,4-pentafluorobutyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)n(CCC(F)(F)C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C8H7F5N2O3/c9-7(10,8(11,12)13)1-2-15-5(16)3-4(14-15)6(17)18/h3,14H,1-2H2,(H,17,18) |
| InChIKey | RYKPJUFGAGTZMF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|