C10H11F5N2O3 — CID 118141473
ethyl 3-oxo-2-(3,3,4,4,4-pentafluorobutyl)-1H-pyrazole-5-carboxylate (PubChem CID 118141473) has the molecular formula C10H11F5N2O3 and a molecular weight of 302.20 g/mol. Its IUPAC name is ethyl 3-oxo-2-(3,3,4,4,4-pentafluorobutyl)-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-oxo-2-(3,3,4,4,4-pentafluorobutyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 118141473 |
| Molecular Formula | C10H11F5N2O3 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | ethyl 3-oxo-2-(3,3,4,4,4-pentafluorobutyl)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)n(CCC(F)(F)C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C10H11F5N2O3/c1-2-20-8(19)6-5-7(18)17(16-6)4-3-9(11,12)10(13,14)15/h5,16H,2-4H2,1H3 |
| InChIKey | FMIFFRBBBFCPCN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|