C24H18N4O2 — CID 118141615
N-[3-(2-oxo-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-5-yl)phenyl]benzamide (PubChem CID 118141615) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[3-(2-oxo-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-5-yl)phenyl]benzamide.
| Compound Name | N-[3-(2-oxo-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 118141615 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[3-(2-oxo-3,6-dihydro-1H-[1,4]diazepino[6,5-b]indol-5-yl)phenyl]benzamide |
| SMILES | O=C1CN=C(c2cccc(NC(=O)c3ccccc3)c2)c2[nH]c3ccccc3c2N1 |
| InChI | InChI=1S/C24H18N4O2/c29-20-14-25-21(23-22(28-20)18-11-4-5-12-19(18)27-23)16-9-6-10-17(13-16)26-24(30)15-7-2-1-3-8-15/h1-13,27H,14H2,(H,26,30)(H,28,29) |
| InChIKey | UQZADYKXVUWXGU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |